2-(1H-Pyrazol-3-yl)-10H-phenothiazine structure
|
Common Name | 2-(1H-Pyrazol-3-yl)-10H-phenothiazine | ||
|---|---|---|---|---|
| CAS Number | 63285-55-2 | Molecular Weight | 265.33300 | |
| Density | 1.337g/cm3 | Boiling Point | 553.546ºC at 760 mmHg | |
| Molecular Formula | C15H11N3S | Melting Point | 225-227ºC | |
| MSDS | N/A | Flash Point | 288.574ºC | |
| Name | 2-(1H-Pyrazol-3-yl)-10H-phenothiazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 553.546ºC at 760 mmHg |
| Melting Point | 225-227ºC |
| Molecular Formula | C15H11N3S |
| Molecular Weight | 265.33300 |
| Flash Point | 288.574ºC |
| Exact Mass | 265.06700 |
| PSA | 66.01000 |
| LogP | 4.42290 |
| Index of Refraction | 1.713 |
| InChIKey | FNWWCIGZVBAOTH-UHFFFAOYSA-N |
| SMILES | c1ccc2c(c1)Nc1cc(-c3ccn[nH]3)ccc1S2 |
| HS Code | 2934999090 |
|---|
|
~%
2-(1H-Pyrazol-3... CAS#:63285-55-2 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 14, p. 345 - 347 |
|
~%
2-(1H-Pyrazol-3... CAS#:63285-55-2 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 14, p. 345 - 347 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(1H-pyrazol-5-yl)-10H-phenothiazine |