3-(Dimethylamino)-1-(10H-phenothiazin-2-yl)-2-propen-1-one
Modify Date: 2025-08-25 12:17:17
3-(Dimethylamino)-1-(10H-phenothiazin-2-yl)-2-propen-1-one structure
|
Common Name | 3-(Dimethylamino)-1-(10H-phenothiazin-2-yl)-2-propen-1-one | ||
|---|---|---|---|---|
| CAS Number | 63285-46-1 | Molecular Weight | 296.38700 | |
| Density | 1.217g/cm3 | Boiling Point | 489.5ºC at 760 mmHg | |
| Molecular Formula | C17H16N2OS | Melting Point | 245-247ºC | |
| MSDS | N/A | Flash Point | 249.9ºC | |
| Name | 3-(Dimethylamino)-1-(10H-phenothiazin-2-yl)-2-propen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 489.5ºC at 760 mmHg |
| Melting Point | 245-247ºC |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.38700 |
| Flash Point | 249.9ºC |
| Exact Mass | 296.09800 |
| PSA | 57.64000 |
| LogP | 4.29080 |
| Index of Refraction | 1.646 |
| InChIKey | ILKTVWQCXKZWMR-MDZDMXLPSA-N |
| SMILES | CN(C)C=CC(=O)c1ccc2c(c1)Nc1ccccc1S2 |
| HS Code | 2934999090 |
|---|
|
~%
3-(Dimethylamin... CAS#:63285-46-1 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 14, p. 345 - 347 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:63285-55-2| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-dimethylamino-1-(10H-phenothiazin-2-yl)-propenone |
| 3-Dimethylamino-1-(2-phenothiazinyl)-2-propen-1-on |