[2,2,2-trichloro-1-(3-chlorophenyl)ethyl] acetate structure
|
Common Name | [2,2,2-trichloro-1-(3-chlorophenyl)ethyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 63252-84-6 | Molecular Weight | 301.98100 | |
| Density | 1.468g/cm3 | Boiling Point | 375.9ºC at 760 mmHg | |
| Molecular Formula | C10H8Cl4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.4ºC | |
| Name | [2,2,2-trichloro-1-(3-chlorophenyl)ethyl] acetate |
|---|
| Density | 1.468g/cm3 |
|---|---|
| Boiling Point | 375.9ºC at 760 mmHg |
| Molecular Formula | C10H8Cl4O2 |
| Molecular Weight | 301.98100 |
| Flash Point | 153.4ºC |
| Exact Mass | 299.92800 |
| PSA | 26.30000 |
| LogP | 4.31440 |
| Index of Refraction | 1.557 |
| InChIKey | PVPSWSJMTSJBKM-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(c1cccc(Cl)c1)C(Cl)(Cl)Cl |
|
~%
[2,2,2-trichlor... CAS#:63252-84-6 |
| Literature: Howard; Stephens Journal of the American Chemical Society, 1938 , vol. 60, p. 228 |
|
~%
[2,2,2-trichlor... CAS#:63252-84-6 |
| Literature: Howard; Stephens Journal of the American Chemical Society, 1938 , vol. 60, p. 228 |
|
~%
[2,2,2-trichlor... CAS#:63252-84-6 |
| Literature: Bayer Patent: DE2540653 , 1977 ; Chem.Abstr., 1977 , vol. 87, # 39131 |