Acetamide,2-cyano-N-9H-xanthen-9-yl- structure
|
Common Name | Acetamide,2-cyano-N-9H-xanthen-9-yl- | ||
|---|---|---|---|---|
| CAS Number | 6325-70-8 | Molecular Weight | 264.27900 | |
| Density | 1.31g/cm3 | Boiling Point | 508.9ºC at 760 mmHg | |
| Molecular Formula | C16H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.5ºC | |
| Name | 2-cyano-N-(9H-xanthen-9-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 508.9ºC at 760 mmHg |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.27900 |
| Flash Point | 261.5ºC |
| Exact Mass | 264.09000 |
| PSA | 62.12000 |
| LogP | 3.30248 |
| Index of Refraction | 1.648 |
| InChIKey | MVYLRQUOBBLKIB-UHFFFAOYSA-N |
| SMILES | N#CCC(=O)NC1c2ccccc2Oc2ccccc21 |
|
~%
Acetamide,2-cya... CAS#:6325-70-8 |
| Literature: Phillips; Pitt Journal of the American Chemical Society, 1943 , vol. 65, p. 1355 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Cyan-essigsaeure-xanthen-9-ylamid |
| cyano-acetic acid xanthen-9-ylamide |