2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide structure
|
Common Name | 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 6325-82-2 | Molecular Weight | 365.44500 | |
| Density | 1.34g/cm3 | Boiling Point | 518.5ºC at 760 mmHg | |
| Molecular Formula | C21H19NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.4ºC | |
| Name | 2,4-dimethyl-N-(9H-xanthen-9-yl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 518.5ºC at 760 mmHg |
| Molecular Formula | C21H19NO3S |
| Molecular Weight | 365.44500 |
| Flash Point | 267.4ºC |
| Exact Mass | 365.10900 |
| PSA | 63.78000 |
| LogP | 5.94870 |
| Index of Refraction | 1.674 |
| InChIKey | WJBVZVXEWPABDI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC2c3ccccc3Oc3ccccc32)c(C)c1 |
|
~%
2,4-dimethyl-N-... CAS#:6325-82-2 |
| Literature: Phillips; Frank Journal of Organic Chemistry, 1944 , vol. 9, p. 9,10 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-Xanthen-9-yl-m-xylol-4-sulfonamid |
| N-xanthen-9-yl-m-xylene-4-sulfonamide |