2-Pyridin-1-yltetralin-1-one structure
|
Common Name | 2-Pyridin-1-yltetralin-1-one | ||
|---|---|---|---|---|
| CAS Number | 6322-29-8 | Molecular Weight | 351.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14INO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-pyridin-1-ium-1-yl-3,4-dihydro-2H-naphthalen-1-one,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14INO |
|---|---|
| Molecular Weight | 351.18200 |
| Exact Mass | 351.01200 |
| PSA | 20.95000 |
| InChIKey | IFMIBJMLYORIAS-UHFFFAOYSA-M |
| SMILES | O=C1c2ccccc2CCC1[n+]1ccccc1.[I-] |
|
~%
2-Pyridin-1-ylt... CAS#:6322-29-8 |
| Literature: King; McWhirter; Rowland Journal of the American Chemical Society, 1948 , vol. 70, p. 239,241 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(1-Oxo-1,2,3,4-tetrahydro-[2]naphthyl)-pyridinium,Jodid |
| 1-Tetralon-2-yl-pyridinium-iodid |
| 1-(1-oxo-1,2,3,4-tetrahydro-[2]naphthyl)-pyridinium,iodide |