4-(benzo[1,3]dioxole-5-carbonyl)-3-[(3,4,5-trimethoxyphenyl)methyl]oxolan-2-one structure
|
Common Name | 4-(benzo[1,3]dioxole-5-carbonyl)-3-[(3,4,5-trimethoxyphenyl)methyl]oxolan-2-one | ||
|---|---|---|---|---|
| CAS Number | 6322-22-1 | Molecular Weight | 414.40500 | |
| Density | 1.316g/cm3 | Boiling Point | 618ºC at 760 mmHg | |
| Molecular Formula | C22H22O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.2ºC | |
| Name | 4-(1,3-benzodioxole-5-carbonyl)-3-[(3,4,5-trimethoxyphenyl)methyl]oxolan-2-one |
|---|
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 618ºC at 760 mmHg |
| Molecular Formula | C22H22O8 |
| Molecular Weight | 414.40500 |
| Flash Point | 269.2ºC |
| Exact Mass | 414.13100 |
| PSA | 89.52000 |
| LogP | 2.65570 |
| Index of Refraction | 1.582 |
| InChIKey | LJUBRCYIPBWVON-UHFFFAOYSA-N |
| SMILES | COc1cc(CC2C(=O)OCC2C(=O)c2ccc3c(c2)OCO3)cc(OC)c1OC |
|
~%
4-(benzo[1,3]di... CAS#:6322-22-1 |
| Literature: Drake; Tuemmler Journal of the American Chemical Society, 1955 , vol. 77, p. 1204,1207 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |