2(3H)-Furanone,4-(1,3-benzodioxol-5-ylhydroxymethyl)dihydro-3-[(3,4,5-trimethoxyphenyl)methyl]- structure
|
Common Name | 2(3H)-Furanone,4-(1,3-benzodioxol-5-ylhydroxymethyl)dihydro-3-[(3,4,5-trimethoxyphenyl)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 6267-80-7 | Molecular Weight | 416.42100 | |
| Density | 1.324g/cm3 | Boiling Point | 606.6ºC at 760mmHg | |
| Molecular Formula | C22H24O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.3ºC | |
| Name | 4-[1,3-benzodioxol-5-yl(hydroxy)methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]oxolan-2-one |
|---|
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 606.6ºC at 760mmHg |
| Molecular Formula | C22H24O8 |
| Molecular Weight | 416.42100 |
| Flash Point | 211.3ºC |
| Exact Mass | 416.14700 |
| PSA | 92.68000 |
| LogP | 2.50640 |
| Index of Refraction | 1.591 |
| InChIKey | VJZSYTJVILGESJ-UHFFFAOYSA-N |
| SMILES | COc1cc(CC2C(=O)OCC2C(O)c2ccc3c(c2)OCO3)cc(OC)c1OC |
|
~%
2(3H)-Furanone,... CAS#:6267-80-7 |
| Literature: Drake; Tuemmler Journal of the American Chemical Society, 1955 , vol. 77, p. 1204,1207 |
|
~%
2(3H)-Furanone,... CAS#:6267-80-7 |
| Literature: Drake; Tuemmler Journal of the American Chemical Society, 1955 , vol. 77, p. 1204,1207 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |