boc-1,2-cis-achc-oh structure
|
Common Name | boc-1,2-cis-achc-oh | ||
|---|---|---|---|---|
| CAS Number | 63216-49-9 | Molecular Weight | 243.29900 | |
| Density | 1.1177 (rough estimate) | Boiling Point | 396.698ºC at 760 mmHg | |
| Molecular Formula | C12H21NO4 | Melting Point | 127-131ºC | |
| MSDS | Chinese USA | Flash Point | 194ºC | |
| Name | cis-2-(tert-Butoxycarbonylamino)cyclohexanecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1177 (rough estimate) |
|---|---|
| Boiling Point | 396.698ºC at 760 mmHg |
| Melting Point | 127-131ºC |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.29900 |
| Flash Point | 194ºC |
| Exact Mass | 243.14700 |
| PSA | 75.63000 |
| LogP | 2.54540 |
| Appearance of Characters | Amorphous Powder | White |
| Index of Refraction | 1.4596 (estimate) |
| InChIKey | QJEQJDJFJWWURK-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCCCC1C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26;S37/S39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| (1R,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylate |
| MFCD01863244 |