3-oxo-1-phenyl-isobenzofuran-1-carboxamide
Modify Date: 2025-09-20 09:57:00
3-oxo-1-phenyl-isobenzofuran-1-carboxamide structure
|
Common Name | 3-oxo-1-phenyl-isobenzofuran-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 6319-77-3 | Molecular Weight | 253.25300 | |
| Density | 1.353g/cm3 | Boiling Point | 544.9ºC at 760 mmHg | |
| Molecular Formula | C15H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.5ºC | |
| Name | 3-oxo-1-phenyl-2-benzofuran-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.353g/cm3 |
|---|---|
| Boiling Point | 544.9ºC at 760 mmHg |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.25300 |
| Flash Point | 308.5ºC |
| Exact Mass | 253.07400 |
| PSA | 69.39000 |
| LogP | 2.28620 |
| Index of Refraction | 1.647 |
| InChIKey | KQQLLDIJRNGTHA-UHFFFAOYSA-N |
| SMILES | NC(=O)C1(c2ccccc2)OC(=O)c2ccccc21 |
|
~%
3-oxo-1-phenyl-... CAS#:6319-77-3 |
| Literature: American Home Products Corporation Patent: US2002/61900 A1, 2002 ; |
|
~52%
3-oxo-1-phenyl-... CAS#:6319-77-3 |
| Literature: Elokdah, Hassan; Chai, Sie-Yearl; Ho, Douglas; Sulkowski, Theodore Bioorganic and Medicinal Chemistry Letters, 2001 , vol. 11, # 3 p. 339 - 342 |
|
~%
3-oxo-1-phenyl-... CAS#:6319-77-3 |
| Literature: Pfeiffer; Jaensch Journal fuer Praktische Chemie (Leipzig), 1941 , vol. <2> 159, p. 241,244, 254 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Oxo-1-phenyl-phthalan-1-carbonsaeure-amid |
| 3-oxo-1-phenyl-phthalan-1-carboxylic acid amide |
| 3-oxo-1-phenyl-1,3-dihydro-2-benzofuran-1-carboxamide |