3-(1h-indol-2-yl)-phenylamine
Modify Date: 2024-01-30 19:23:07
3-(1h-indol-2-yl)-phenylamine structure
|
Common Name | 3-(1h-indol-2-yl)-phenylamine | ||
|---|---|---|---|---|
| CAS Number | 6318-72-5 | Molecular Weight | 208.25800 | |
| Density | 1.229g/cm3 | Boiling Point | 476.7ºC at 760 mmHg | |
| Molecular Formula | C14H12N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.6ºC | |
| Name | 3-(1H-indol-2-yl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.229g/cm3 |
|---|---|
| Boiling Point | 476.7ºC at 760 mmHg |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.25800 |
| Flash Point | 273.6ºC |
| Exact Mass | 208.10000 |
| PSA | 41.81000 |
| LogP | 3.99830 |
| Index of Refraction | 1.726 |
| InChIKey | KMPALQUHKFNPAB-UHFFFAOYSA-N |
| SMILES | Nc1cccc(-c2cc3ccccc3[nH]2)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~83%
3-(1h-indol-2-y... CAS#:6318-72-5 |
| Literature: UNIVERSITE DE STRASBOURG; CENTRE NATIONAL DE LA RECHERCHE SCIENTIFIQUE Patent: US2012/196865 A1, 2012 ; Location in patent: Page/Page column 13 ; |
|
~58%
3-(1h-indol-2-y... CAS#:6318-72-5 |
| Literature: Yu, Xufen; Park, Eun-Jung; Kondratyuk, Tamara P.; Pezzuto, John M.; Sun, Dianqing Organic and Biomolecular Chemistry, 2012 , vol. 10, # 44 p. 8835 - 8847 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(3-Aminophenyl)-1H-indole |
| 3-indol-2-yl-aniline |
| Benzenamine,3-(1H-indol-2-yl) |
| 2-(2,4,5-TRIFLUOROPHENYL)ETHANOL,JRD |
| 2-(3-aminophenyl)indole |
| 2-(3'-Aminophenyl)-indol |