4-Thiazolidinone,5-[(2-chlorophenyl)methylene]-2-thioxo- structure
|
Common Name | 4-Thiazolidinone,5-[(2-chlorophenyl)methylene]-2-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 6318-36-1 | Molecular Weight | 255.74400 | |
| Density | 1.54g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H6ClNOS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5Z)-5-[(2-chlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Molecular Formula | C10H6ClNOS2 |
| Molecular Weight | 255.74400 |
| Exact Mass | 254.95800 |
| PSA | 86.49000 |
| LogP | 3.15760 |
| Index of Refraction | 1.738 |
| InChIKey | AAIBSXUAGRXSIQ-YVMONPNESA-N |
| SMILES | O=C1NC(=S)SC1=Cc1ccccc1Cl |
|
~95%
4-Thiazolidinon... CAS#:6318-36-1 |
| Literature: Alizadeh, Abdolhamid; Khodaei, Mohammad M.; Eshghi, Ali Canadian Journal of Chemistry, 2010 , vol. 88, # 6 p. 514 - 518 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| JoCDXEfDQHPxQdTTRQbTS]mpDCTrPHP |