1,4-Butanedione, 2-bromo-1,4-diphenyl- structure
|
Common Name | 1,4-Butanedione, 2-bromo-1,4-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 63104-99-4 | Molecular Weight | 317.17700 | |
| Density | 1.397g/cm3 | Boiling Point | 439.3ºC at 760 mmHg | |
| Molecular Formula | C16H13BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.4ºC | |
| Name | 2-bromo-1,4-diphenylbutane-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.397g/cm3 |
|---|---|
| Boiling Point | 439.3ºC at 760 mmHg |
| Molecular Formula | C16H13BrO2 |
| Molecular Weight | 317.17700 |
| Flash Point | 122.4ºC |
| Exact Mass | 316.01000 |
| PSA | 34.14000 |
| LogP | 3.90580 |
| Index of Refraction | 1.605 |
| InChIKey | POAJBEKARGGZCV-UHFFFAOYSA-N |
| SMILES | O=C(CC(Br)C(=O)c1ccccc1)c1ccccc1 |
|
~%
1,4-Butanedione... CAS#:63104-99-4 |
| Literature: Bolognese,A.; Scherillo,G. Journal of Organic Chemistry, 1977 , vol. 42, p. 3867 - 3869 |
|
~2%
1,4-Butanedione... CAS#:63104-99-4 |
| Literature: Sayama, Shinsei; Inamura, Yutaka Chemistry Letters, 1996 , # 8 p. 633 - 634 |
|
~%
1,4-Butanedione... CAS#:63104-99-4 |
| Literature: Campbell; Khanna Journal of the Chemical Society, 1949 , p. Spl. 33, 35 |
|
~%
1,4-Butanedione... CAS#:63104-99-4 |
| Literature: Paal; Schulze Chemische Berichte, 1902 , vol. 35, p. 171,172 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| 2-Brom-1,4-diphenyl-butan-1,4-dion |
| 2-bromo-1,4-diphenyl-butane-1,4-dione |
| 2-Brom-1,4-diphenyl-1,4-butandion |
| 1-Brom-1.2-dibenzoyl-aethan |
| 1,2-bromo-1,4-diphenyl |
| 2-bromo-1,4-diphenyl-1,4-butanedione |