1-[bis(4-dimethylaminophenyl)methyl]naphthalen-2-ol
Modify Date: 2025-08-29 09:56:45
![1-[bis(4-dimethylaminophenyl)methyl]naphthalen-2-ol Structure](https://image.chemsrc.com/caspic/369/6310-65-2.png)
1-[bis(4-dimethylaminophenyl)methyl]naphthalen-2-ol structure
|
Common Name | 1-[bis(4-dimethylaminophenyl)methyl]naphthalen-2-ol | ||
|---|---|---|---|---|
| CAS Number | 6310-65-2 | Molecular Weight | 396.52400 | |
| Density | 1.162g/cm3 | Boiling Point | 587.7ºC at 760 mmHg | |
| Molecular Formula | C27H28N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.7ºC | |
| Name | 1-[bis[4-(dimethylamino)phenyl]methyl]naphthalen-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 587.7ºC at 760 mmHg |
| Molecular Formula | C27H28N2O |
| Molecular Weight | 396.52400 |
| Flash Point | 305.7ºC |
| Exact Mass | 396.22000 |
| PSA | 26.71000 |
| LogP | 5.85760 |
| Index of Refraction | 1.675 |
| InChIKey | LURCDXAYULMBMM-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(c2ccc(N(C)C)cc2)c2c(O)ccc3ccccc23)cc1 |
|
~%
1-[bis(4-dimeth... CAS#:6310-65-2 |
| Literature: Votocek; Jelinek Chemische Berichte, 1907 , vol. 40, p. 409 |
|
~%
1-[bis(4-dimeth... CAS#:6310-65-2 |
| Literature: Sandoz and Co. Patent: DE81677 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 220 |
|
~%
1-[bis(4-dimeth... CAS#:6310-65-2 |
| Literature: Votocek; Jelinek Chemische Berichte, 1907 , vol. 40, p. 409 |
![Bis[4-(dimethylamino)phenyl]methanol structure](https://image.chemsrc.com/caspic/142/119-58-4.png)
![4-Dimethylamino-α-[4-(dimethylamino)phenyl]benzenemethanamine structure](https://image.chemsrc.com/caspic/261/2123-34-4.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-{bis[4-(dimethylamino)phenyl]methyl}naphthalen-2-ol |
| 1-(4,4'-Bis-dimethylamino-benzhydryl)-[2]naphthol |
| Bis-(4-dimethylamino-phenyl)-(2-oxy-naphthyl-(1))-methan |