2-bromo-1-(tert-butyl)-4-nitrobenzene structure
|
Common Name | 2-bromo-1-(tert-butyl)-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 6310-17-4 | Molecular Weight | 258.11200 | |
| Density | 1.401g/cm3 | Boiling Point | 298ºC at 760 mmHg | |
| Molecular Formula | C10H12BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134ºC | |
| Name | 2-bromo-1-tert-butyl-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.401g/cm3 |
|---|---|
| Boiling Point | 298ºC at 760 mmHg |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.11200 |
| Flash Point | 134ºC |
| Exact Mass | 257.00500 |
| PSA | 45.82000 |
| LogP | 4.17800 |
| Index of Refraction | 1.552 |
| InChIKey | VIXSTSCFPDRETO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc([N+](=O)[O-])cc1Br |
| HS Code | 2904909090 |
|---|
|
~99%
2-bromo-1-(tert... CAS#:6310-17-4 |
| Literature: Vertex Pharmaceuticals Incorported Patent: US2011/98311 A1, 2011 ; Title/Abstract Full Text Show Details Vertex Pharmaceuticals Incorporated Patent: US2012/309758 A1, 2012 ; US 20120309758 A1 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-bromo-1-tert-butyl-4-nitro-benzene |
| 1-(tert-butyl)-2-bromo-4-nitrobenzene |
| 2-Brom-1-tert-butyl-4-nitro-benzol |
| 2-BROMO-4-NITRO-1-TERT-BUTYL-BENZENE |
| benzene,2-bromo-1-(1,1-dimethylethyl)-4-nitro |
| 3-bromo-4-tert-butylnitrobenzene |