2-(1-tert-butyl-4-oxocyclohexa-2,5-dien-1-yl)oxyacetaldehyde structure
|
Common Name | 2-(1-tert-butyl-4-oxocyclohexa-2,5-dien-1-yl)oxyacetaldehyde | ||
|---|---|---|---|---|
| CAS Number | 881181-49-3 | Molecular Weight | 208.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1-tert-butyl-4-oxocyclohexa-2,5-dien-1-yl)oxyacetaldehyde |
|---|
| Molecular Formula | C12H16O3 |
|---|---|
| Molecular Weight | 208.25400 |
| Exact Mass | 208.11000 |
| PSA | 43.37000 |
| LogP | 1.68190 |
| InChIKey | AOBCQQYTYBUMNZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1(OCC=O)C=CC(=O)C=C1 |
|
~%
2-(1-tert-butyl... CAS#:881181-49-3 |
| Literature: Liu, Qin; Rovis, Tomislav Journal of the American Chemical Society, 2006 , vol. 128, # 8 p. 2552 - 2553 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |