4-Piperidinecarboxamide,1-benzoyl-N,N-diethyl- structure
|
Common Name | 4-Piperidinecarboxamide,1-benzoyl-N,N-diethyl- | ||
|---|---|---|---|---|
| CAS Number | 6308-69-6 | Molecular Weight | 288.38500 | |
| Density | 1.098g/cm3 | Boiling Point | 459.1ºC at 760 mmHg | |
| Molecular Formula | C17H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.4ºC | |
| Name | 1-benzoyl-N,N-diethylpiperidine-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.098g/cm3 |
|---|---|
| Boiling Point | 459.1ºC at 760 mmHg |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.38500 |
| Flash Point | 199.4ºC |
| Exact Mass | 288.18400 |
| PSA | 40.62000 |
| LogP | 2.34510 |
| Index of Refraction | 1.545 |
| InChIKey | LSMHDPQURDDMBU-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1CCN(C(=O)c2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
|
~%
4-Piperidinecar... CAS#:6308-69-6 |
| Literature: Swain; Naegele Journal of the American Chemical Society, 1957 , vol. 79, p. 5250,5252 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-benzoyl-piperidine-4-carboxylic acid diethylamide |
| Isonipecotamide,1-benzoyl-N,N-diethyl |
| 1-Benzoyl-piperidin-4-carbonsaeure-diaethylamid |
| 1-Benzoyl-N,N-diethyl-4-piperidinecarboxamide |