tert-Butyl 6-(benzyloxy)-3-formyl-1H-indole-1-carboxylate structure
|
Common Name | tert-Butyl 6-(benzyloxy)-3-formyl-1H-indole-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 630110-71-3 | Molecular Weight | 351.396 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 511.7±58.0 °C at 760 mmHg | |
| Molecular Formula | C21H21NO4 | Melting Point | 118-119°C | |
| MSDS | N/A | Flash Point | 263.3±32.3 °C | |
| Name | tert-butyl 3-formyl-6-phenylmethoxyindole-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 511.7±58.0 °C at 760 mmHg |
| Melting Point | 118-119°C |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.396 |
| Flash Point | 263.3±32.3 °C |
| Exact Mass | 351.147064 |
| PSA | 57.53000 |
| LogP | 4.86 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | BIGAKQBLDWFYEU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)n1cc(C=O)c2ccc(OCc3ccccc3)cc21 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~96%
tert-Butyl 6-(b... CAS#:630110-71-3 |
| Literature: Montagne, Cyril; Fournet, Guy; Joseph, Benoit Synthesis, 2005 , # 1 art. no. T08504SS, p. 136 - 146 |
|
~%
tert-Butyl 6-(b... CAS#:630110-71-3 |
| Literature: Synlett, , # 10 p. 1533 - 1535 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| OR1677 |
| tert-Butyl 6-(benzyloxy)-3-formyl-1H-indole-1-carboxylate |
| tert-butyl 6-benzyloxy-3-formyl-1H-indole-1-carboxylate |
| 1-Boc-6-Benzyloxy-3-formylindole |
| 1H-Indole-1-carboxylic acid, 3-formyl-6-(phenylmethoxy)-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 6-(benzyloxy)-3-formyl-1H-indole-1-carboxylate |