2-Naphthalenecarboxylicacid, 1-(acetyloxy)- structure
|
Common Name | 2-Naphthalenecarboxylicacid, 1-(acetyloxy)- | ||
|---|---|---|---|---|
| CAS Number | 6301-40-2 | Molecular Weight | 230.21600 | |
| Density | 1.325g/cm3 | Boiling Point | 394.9ºC at 760 mmHg | |
| Molecular Formula | C13H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154ºC | |
| Name | 1-acetyloxynaphthalene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 394.9ºC at 760 mmHg |
| Molecular Formula | C13H10O4 |
| Molecular Weight | 230.21600 |
| Flash Point | 154ºC |
| Exact Mass | 230.05800 |
| PSA | 63.60000 |
| LogP | 2.46330 |
| Index of Refraction | 1.637 |
| InChIKey | OTXGVXYCMIJUGJ-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1c(C(=O)O)ccc2ccccc12 |
| HS Code | 2918990090 |
|---|
|
~%
2-Naphthaleneca... CAS#:6301-40-2 |
| Literature: Weil; Heerdt Chemische Berichte, 1922 , vol. 55, p. 230 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Acetyloxy-2-naphthoic acid |
| 1-Acetoxy-naphthoesaeure-2 |
| 1-Acetoxy-<2>naphthoesaeure |