1-iodo-2,5-dimethoxy-4-nitro-benzene structure
|
Common Name | 1-iodo-2,5-dimethoxy-4-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 6301-35-5 | Molecular Weight | 309.05800 | |
| Density | 1.803g/cm3 | Boiling Point | 395.1ºC at 760 mmHg | |
| Molecular Formula | C8H8INO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.8ºC | |
| Name | 1-iodo-2,5-dimethoxy-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.803g/cm3 |
|---|---|
| Boiling Point | 395.1ºC at 760 mmHg |
| Molecular Formula | C8H8INO4 |
| Molecular Weight | 309.05800 |
| Flash Point | 192.8ºC |
| Exact Mass | 308.95000 |
| PSA | 64.28000 |
| LogP | 2.73980 |
| Index of Refraction | 1.605 |
| InChIKey | ZKEPXTRWLFMRSE-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])c(OC)cc1I |
|
~%
1-iodo-2,5-dime... CAS#:6301-35-5 |
| Literature: Robinson Journal of the Chemical Society, 1916 , vol. 109, p. 1087 |
|
~%
1-iodo-2,5-dime... CAS#:6301-35-5 |
| Literature: Robinson Journal of the Chemical Society, 1916 , vol. 109, p. 1087 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-Jod-2,5-dimethoxy-4-nitro-benzol |
| 1-iodo-2,5-dimethoxy-4-nitro-benzene |
| 5-Jod-2-nitro-hydrochinon-dimethylaether |