1-(Bromomethyl)-3,5-di-tert-butylbenzene structure
|
Common Name | 1-(Bromomethyl)-3,5-di-tert-butylbenzene | ||
|---|---|---|---|---|
| CAS Number | 62938-08-3 | Molecular Weight | 283.247 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 279.7±9.0 °C at 760 mmHg | |
| Molecular Formula | C15H23Br | Melting Point | 30 °C | |
| MSDS | Chinese USA | Flash Point | 111.3±11.8 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 1-(bromomethyl)-3,5-ditert-butylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 279.7±9.0 °C at 760 mmHg |
| Melting Point | 30 °C |
| Molecular Formula | C15H23Br |
| Molecular Weight | 283.247 |
| Flash Point | 111.3±11.8 °C |
| Exact Mass | 282.098297 |
| LogP | 6.30 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | SNRYBGHMHAJTTM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(CBr)cc(C(C)(C)C)c1 |
| Storage condition | Refrigerator |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | Ⅱ |
| HS Code | 2903999090 |
|
~88%
1-(Bromomethyl)... CAS#:62938-08-3 |
| Literature: Fournier, Diane; Poirier, Donald European Journal of Medicinal Chemistry, 2011 , vol. 46, # 9 p. 4227 - 4237 |
|
~82%
1-(Bromomethyl)... CAS#:62938-08-3 |
| Literature: McCallum, Jeremy E. B.; Huston, Kenneth G.; McSweeney, Jacqueline M.; Rucker, Brandie G. Synlett, 2010 , # 19 p. 2871 - 2874 |
|
~%
1-(Bromomethyl)... CAS#:62938-08-3 |
| Literature: European Journal of Medicinal Chemistry, , vol. 33, # 5 p. 363 - 374 |
|
~%
1-(Bromomethyl)... CAS#:62938-08-3 |
| Literature: Tetrahedron, , vol. 58, # 12 p. 2405 - 2413 |
|
~%
1-(Bromomethyl)... CAS#:62938-08-3 |
| Literature: European Journal of Medicinal Chemistry, , vol. 46, # 9 p. 4227 - 4237 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,5-di-tert-butyl(bromomethyl)benzene |
| MFCD03701623 |
| 1-(5-Hexyn-1-yl)-4,4′-bipyridinium bis(hexafluorophosphate) |
| Benzene, 1-(bromomethyl)-3,5-bis(1,1-dimethylethyl)- |
| 3,5-Di-tert-butylbenzyl bromide |
| 1-Bromomethyl-3,5-di-tert-butylbenzene |
| 1-(Bromomethyl)-3,5-di-tert-butylbenzene |
| 3,5-di(t-butyl)(bromomethyl)benzene |
| 1-(Bromomethyl)-3,5-bis(2-methyl-2-propanyl)benzene |