(1E)-1,5-bis(5-bromo-2-hydroxy-phenyl)penta-1,4-dien-3-one structure
|
Common Name | (1E)-1,5-bis(5-bromo-2-hydroxy-phenyl)penta-1,4-dien-3-one | ||
|---|---|---|---|---|
| CAS Number | 6291-00-5 | Molecular Weight | 424.08300 | |
| Density | 1.751g/cm3 | Boiling Point | 571.8ºC at 760 mmHg | |
| Molecular Formula | C17H12Br2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.6ºC | |
| Name | 1,5-bis(5-bromo-2-hydroxyphenyl)penta-1,4-dien-3-one |
|---|
| Density | 1.751g/cm3 |
|---|---|
| Boiling Point | 571.8ºC at 760 mmHg |
| Molecular Formula | C17H12Br2O3 |
| Molecular Weight | 424.08300 |
| Flash Point | 299.6ºC |
| Exact Mass | 421.91500 |
| PSA | 57.53000 |
| LogP | 4.91850 |
| Index of Refraction | 1.731 |
| InChIKey | GHQJYKKGXCSWOF-UHFFFAOYSA-N |
| SMILES | O=C(C=Cc1cc(Br)ccc1O)C=Cc1cc(Br)ccc1O |
|
~%
(1E)-1,5-bis(5-... CAS#:6291-00-5 |
| Literature: Fabinyi; Szeki Chemische Berichte, 1907 , vol. 40, p. 3460 |
|
~%
(1E)-1,5-bis(5-... CAS#:6291-00-5 |
| Literature: McGookin; Sinclair Journal of the Chemical Society, 1928 , p. 1175 |
|
~%
(1E)-1,5-bis(5-... CAS#:6291-00-5 |
| Literature: McGookin; Sinclair Journal of the Chemical Society, 1928 , p. 1175 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |