CARBOXYMETHYL SEPHADEX
CARBOXYMETHYL SEPHADEX structure
|
Common Name | CARBOXYMETHYL SEPHADEX | ||
|---|---|---|---|---|
| CAS Number | 62886-59-3 | Molecular Weight | 375.864 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 529.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H23ClFNO2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 273.8±30.1 °C | |
| Name | haloperidol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 529.0±50.0 °C at 760 mmHg |
| Molecular Formula | C21H23ClFNO2 |
| Molecular Weight | 375.864 |
| Flash Point | 273.8±30.1 °C |
| Exact Mass | 375.140137 |
| LogP | 3.01 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | VLTCYJIYVOLIJU-UHFFFAOYSA-N |
| SMILES | CC(CC=Cc1cc(C=CCC(C)c2ccccc2)cc(C=CCC(c2ccccc2)[Si](C)(C)c2ccccc2)c1)O[Si](C)(C)c1ccccc1.C[Si](C)=O.C[Si](C)=O |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Purification and characterization of chymodenin. A hormone-like peptide from porcine duodenum.
J. Biol. Chem. 261(23) , 10569-10575, (1986) Chymodenin, a hormone-like duodenal peptide which rapidly alters the proportions of secreted pancreatic digestive enzymes to a mixture relatively richer in chymotrypsinogen than that found in basal se... |
|
|
Multiple modes of interaction between the methylated DNA binding protein MeCP2 and chromatin.
Mol. Cell. Biol. 27(3) , 864-877, (2007) Mutations of the methylated DNA binding protein MeCP2, a multifunctional protein that is thought to transmit epigenetic information encoded as methylated CpG dinucleotides to the transcriptional machi... |
|
|
A novel serine protease inhibitor from Bungarus fasciatus venom.
Peptides 29 , 369-374, (2008) By Sephadex G-50 gel filtration, cation-exchange CM-Sephadex C-25 chromatography and reversed phase high-performance liquid chromatography (HPLC), a novel serine protease inhibitor named bungaruskunin... |
| Brotopon |
| Einalon S |
| Eukystol |
| 4-[4-(4-Chlorophenyl)-4-hydroxy-1-piperidinyl]-1-(4-fluorophenyl)-1-butanone |
| Peluces |
| Haldol |
| Halosten |
| Linton |
| Aloperidin |
| 4-[4-(p-Chlorophenyl)-4-hydroxypiperidino]-4'-fluorobutyrophenone |
| Sigaperidol |
| Butyrophenone, 4-[4- (p-chlorophenyl)-4-hydroxypiperidino]-4'-fluoro- |
| haloperidol |
| Haloperidol [USAN:BAN:INN:JAN] |
| 1-Butanone, 4-[4- (4-chlorophenyl)-4-hydroxy-1-piperidinyl]-1-(4-fluorophenyl)- |
| 1-Butanone, 4-[4-(4-chlorophenyl)-4-hydroxy-1-piperidinyl]-1-(4-fluorophenyl)- |
| 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one |
| Serenace |
| 4-[4-(4-Chlorphenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorphenyl)butan-1-on |
| Bioperidolo |
| Dozic |
| Keselan |