Phenol,2,6-bis[(dimethylamino)methyl]-4-(1,1,3,3-tetramethylbutyl)- structure
|
Common Name | Phenol,2,6-bis[(dimethylamino)methyl]-4-(1,1,3,3-tetramethylbutyl)- | ||
|---|---|---|---|---|
| CAS Number | 6285-80-9 | Molecular Weight | 320.51300 | |
| Density | 0.96g/cm3 | Boiling Point | 373.5ºC at 760mmHg | |
| Molecular Formula | C20H36N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.9ºC | |
| Name | 2,6-bis[(dimethylamino)methyl]-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|
| Density | 0.96g/cm3 |
|---|---|
| Boiling Point | 373.5ºC at 760mmHg |
| Molecular Formula | C20H36N2O |
| Molecular Weight | 320.51300 |
| Flash Point | 126.9ºC |
| Exact Mass | 320.28300 |
| PSA | 26.71000 |
| LogP | 4.22920 |
| Index of Refraction | 1.516 |
| InChIKey | NOCZUJDWKXXYKK-UHFFFAOYSA-N |
| SMILES | CN(C)Cc1cc(C(C)(C)CC(C)(C)C)cc(CN(C)C)c1O |
|
~%
Phenol,2,6-bis[... CAS#:6285-80-9 |
| Literature: Roehm and Haas Co. Patent: US2033092 , 1933 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |