pentyl 2-pentoxycarbonyloxypropanoate
Modify Date: 2025-09-23 13:36:15
pentyl 2-pentoxycarbonyloxypropanoate structure
|
Common Name | pentyl 2-pentoxycarbonyloxypropanoate | ||
|---|---|---|---|---|
| CAS Number | 6283-91-6 | Molecular Weight | 274.35300 | |
| Density | 1.003g/cm3 | Boiling Point | 329.9ºC at 760 mmHg | |
| Molecular Formula | C14H26O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.1ºC | |
| Name | pentyl 2-pentoxycarbonyloxypropanoate |
|---|
| Density | 1.003g/cm3 |
|---|---|
| Boiling Point | 329.9ºC at 760 mmHg |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.35300 |
| Flash Point | 139.1ºC |
| Exact Mass | 274.17800 |
| PSA | 61.83000 |
| LogP | 3.45170 |
| Index of Refraction | 1.44 |
| InChIKey | DBGWPSMXXMOEGB-UHFFFAOYSA-N |
| SMILES | CCCCCOC(=O)OC(C)C(=O)OCCCCC |
|
~%
pentyl 2-pentox... CAS#:6283-91-6 |
| Literature: Rehberg; Dixon Journal of Organic Chemistry, 1950 , vol. 15, p. 973 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |