Ethanone,2-(2-chlorophenyl)-1-[4-(dimethylamino)phenyl]-2-hydroxy- structure
|
Common Name | Ethanone,2-(2-chlorophenyl)-1-[4-(dimethylamino)phenyl]-2-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 6275-08-7 | Molecular Weight | 289.75700 | |
| Density | 1.26g/cm3 | Boiling Point | 462.4ºC at 760 mmHg | |
| Molecular Formula | C16H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.4ºC | |
| Name | 2-(2-chlorophenyl)-1-[4-(dimethylamino)phenyl]-2-hydroxyethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 462.4ºC at 760 mmHg |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.75700 |
| Flash Point | 233.4ºC |
| Exact Mass | 289.08700 |
| PSA | 40.54000 |
| LogP | 3.32230 |
| Index of Refraction | 1.627 |
| InChIKey | MDDZERLNZSGENP-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(=O)C(O)c2ccccc2Cl)cc1 |
|
~%
Ethanone,2-(2-c... CAS#:6275-08-7 |
| Literature: Buck; Ide Journal of the American Chemical Society, 1930 , vol. 52, p. 220,223 |
| 2'-chloro-4-dimethylamino-benzoin |
| 2'-Chlor-4-dimethylamino-benzoin |