Benzoicacid, 2-[[(2-chlorophenyl)amino]carbonyl]- structure
|
Common Name | Benzoicacid, 2-[[(2-chlorophenyl)amino]carbonyl]- | ||
|---|---|---|---|---|
| CAS Number | 6273-12-7 | Molecular Weight | 275.68700 | |
| Density | 1.43g/cm3 | Boiling Point | 380.4ºC at 760 mmHg | |
| Molecular Formula | C14H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.9ºC | |
| Name | 2-[(2-chlorophenyl)carbamoyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 380.4ºC at 760 mmHg |
| Molecular Formula | C14H10ClNO3 |
| Molecular Weight | 275.68700 |
| Flash Point | 183.9ºC |
| Exact Mass | 275.03500 |
| PSA | 66.40000 |
| LogP | 3.36350 |
| Index of Refraction | 1.677 |
| InChIKey | HTQXDQHRVQQKQH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)Nc1ccccc1Cl |
| HS Code | 2924299090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-<2-Chlor-phenyl>-phtalaminsaeure |