4-Ethoxyphenyl 4-Butylbenzoate structure
|
Common Name | 4-Ethoxyphenyl 4-Butylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 62716-65-8 | Molecular Weight | 298.37600 | |
| Density | 1.068g/cm3 | Boiling Point | 429.7ºC at 760 mmHg | |
| Molecular Formula | C19H22O3 | Melting Point | 63ºC | |
| MSDS | N/A | Flash Point | 183.2ºC | |
| Name | 4-Ethoxyphenyl 4-Butylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.068g/cm3 |
|---|---|
| Boiling Point | 429.7ºC at 760 mmHg |
| Melting Point | 63ºC |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.37600 |
| Flash Point | 183.2ºC |
| Exact Mass | 298.15700 |
| PSA | 35.53000 |
| LogP | 4.64710 |
| Index of Refraction | 1.543 |
| InChIKey | DDDWTNWRNNRWNQ-UHFFFAOYSA-N |
| SMILES | CCCCc1ccc(C(=O)Oc2ccc(OCC)cc2)cc1 |
| HS Code | 2916399090 |
|---|
|
~%
4-Ethoxyphenyl ... CAS#:62716-65-8 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. 320, p. 191 - 205 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (4-ethoxyphenyl) 4-butylbenzoate |