Pyridinium, 2-bromo-1-[2-(4-chlorophenyl)-2-oxoethyl]-,bromide (1:1) structure
|
Common Name | Pyridinium, 2-bromo-1-[2-(4-chlorophenyl)-2-oxoethyl]-,bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 6269-26-7 | Molecular Weight | 391.48600 | |
| Density | 1.507g/cm3 | Boiling Point | 432.4ºC at 760mmHg | |
| Molecular Formula | C13H10Br2ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.3ºC | |
| Name | 2-(2-bromopyridin-1-ium-1-yl)-1-(4-chlorophenyl)ethanone,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.507g/cm3 |
|---|---|
| Boiling Point | 432.4ºC at 760mmHg |
| Molecular Formula | C13H10Br2ClNO |
| Molecular Weight | 391.48600 |
| Flash Point | 215.3ºC |
| Exact Mass | 388.88200 |
| PSA | 20.95000 |
| LogP | 0.27690 |
| Index of Refraction | 1.619 |
| InChIKey | TXHYLBIWOLVXOT-UHFFFAOYSA-M |
| SMILES | O=C(C[n+]1ccccc1Br)c1ccc(Cl)cc1.[Br-] |
|
~%
Pyridinium, 2-b... CAS#:6269-26-7 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3499 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(2-BROMOPYRIDIN-1-IUM-1-YL)-1-(4-CHLOROPHENYL)ETHANONE BROMIDE |
| 2-(2-bromopyridin-1-ium-1-yl)-1-(4-chlorophenyl)ethanone |
| 2-bromo-1-(4-chloro-phenacyl)-pyridinium,bromide |
| 2-Brom-1-(4-chlor-phenacyl)-pyridinium,Bromid |