(S)-1-(4-Fluorobenzoyl)pyrrolidine-2-carboxylic acid
Modify Date: 2025-09-01 11:55:45
(S)-1-(4-Fluorobenzoyl)pyrrolidine-2-carboxylic acid structure
|
Common Name | (S)-1-(4-Fluorobenzoyl)pyrrolidine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 62522-93-4 | Molecular Weight | 237.22700 | |
| Density | 1.369g/cm3 | Boiling Point | 441.6ºC at 760 mmHg | |
| Molecular Formula | C12H12FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.9ºC | |
| Name | (S)-1-(4-Fluorobenzoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.369g/cm3 |
|---|---|
| Boiling Point | 441.6ºC at 760 mmHg |
| Molecular Formula | C12H12FNO3 |
| Molecular Weight | 237.22700 |
| Flash Point | 220.9ºC |
| Exact Mass | 237.08000 |
| PSA | 57.61000 |
| LogP | 1.45280 |
| Index of Refraction | 1.581 |
| InChIKey | LTUZWGRJHXDJQU-JTQLQIEISA-N |
| SMILES | O=C(O)C1CCCN1C(=O)c1ccc(F)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~88%
(S)-1-(4-Fluoro... CAS#:62522-93-4 |
| Literature: MERCKLE GMBH Patent: EP1246825 B1, 2003 ; Location in patent: Page 32 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2S)-1-(4-fluorobenzoyl)pyrrolidine-2-carboxylic acid |