2-(4-Biphenylyl)-2-hydroxypropionic acid structure
|
Common Name | 2-(4-Biphenylyl)-2-hydroxypropionic acid | ||
|---|---|---|---|---|
| CAS Number | 6244-54-8 | Molecular Weight | 242.27000 | |
| Density | 1.195g/cm3 | Boiling Point | 405.1ºC at 760 mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.5ºC | |
| Name | phenyl 2-hydroxy-2-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.195g/cm3 |
|---|---|
| Boiling Point | 405.1ºC at 760 mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Flash Point | 172.5ºC |
| Exact Mass | 242.09400 |
| PSA | 46.53000 |
| LogP | 2.49970 |
| Index of Refraction | 1.584 |
| InChIKey | WBOKEHVGWRVHHZ-UHFFFAOYSA-N |
| SMILES | CC(O)(C(=O)Oc1ccccc1)c1ccccc1 |
| HS Code | 2918199090 |
|---|
|
~81%
2-(4-Biphenylyl... CAS#:6244-54-8 |
| Literature: Damodar, Janmanchi; Krishna Mohan, Srinivasulu Reddy; Jayarama Reddy, Srinivasulu Reddy Synthesis, 2002 , # 3 p. 399 - 402 |
|
~%
2-(4-Biphenylyl... CAS#:6244-54-8 |
| Literature: Blicke; Grier Journal of the American Chemical Society, 1943 , vol. 65, p. 1725,1727 |
|
~%
2-(4-Biphenylyl... CAS#:6244-54-8 |
| Literature: Kuchar; Brunova; Rejholec; et al. Collection of Czechoslovak Chemical Communications, 1984 , vol. 49, # 1 p. 122 - 136 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Biphenyl-4-yl-2-hydroxy-propionsaeure |
| Methyl-4-phenylmandelic acid |
| 2-biphenyl-4-yl-2-hydroxy-propionic acid |