4,5-Dichloro-2-(4-(trifluoromethyl)phenyl)pyridazin-3(2H)-one structure
|
Common Name | 4,5-Dichloro-2-(4-(trifluoromethyl)phenyl)pyridazin-3(2H)-one | ||
|---|---|---|---|---|
| CAS Number | 62436-07-1 | Molecular Weight | 309.07100 | |
| Density | 1.55g/cm3 | Boiling Point | 328.6ºC at 760 mmHg | |
| Molecular Formula | C11H5Cl2F3N2O | Melting Point | 139-140ºC | |
| MSDS | N/A | Flash Point | 152.5ºC | |
| Name | 4,5-Dichloro-2-(4-(trifluoromethyl)phenyl)pyridazin-3(2H)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 328.6ºC at 760 mmHg |
| Melting Point | 139-140ºC |
| Molecular Formula | C11H5Cl2F3N2O |
| Molecular Weight | 309.07100 |
| Flash Point | 152.5ºC |
| Exact Mass | 307.97300 |
| PSA | 34.89000 |
| LogP | 3.55810 |
| Index of Refraction | 1.573 |
| InChIKey | JPRADYWRQUBOIS-UHFFFAOYSA-N |
| SMILES | O=c1c(Cl)c(Cl)cnn1-c1ccc(C(F)(F)F)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,5-dichloro-2-[4-(trifluoromethyl)phenyl]pyridazin-3-one |