2-[2-[(4-chlorobenzoyl)amino]-4-methylphenoxy]acetic acid structure
|
Common Name | 2-[2-[(4-chlorobenzoyl)amino]-4-methylphenoxy]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 6239-19-6 | Molecular Weight | 319.74000 | |
| Density | 1.38g/cm3 | Boiling Point | 433.2ºC at 760 mmHg | |
| Molecular Formula | C16H14ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.8ºC | |
| Name | 2-[2-[(4-chlorobenzoyl)amino]-4-methylphenoxy]acetic acid |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 433.2ºC at 760 mmHg |
| Molecular Formula | C16H14ClNO4 |
| Molecular Weight | 319.74000 |
| Flash Point | 215.8ºC |
| Exact Mass | 319.06100 |
| PSA | 75.63000 |
| LogP | 3.43710 |
| Index of Refraction | 1.639 |
| InChIKey | ATCCULIXHDBBSP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OCC(=O)O)c(NC(=O)c2ccc(Cl)cc2)c1 |
|
~%
2-[2-[(4-chloro... CAS#:6239-19-6 |
| Literature: Drain; Daly; Davy; Horlington; Howes; Scruton; Selway The Journal of pharmacy and pharmacology, 1970 , vol. 22, # 9 p. 684 - 693 |