methyl 4-[(8-methyl-2-oxo-4-phenylchromen-7-yl)oxymethyl]benzoate structure
|
Common Name | methyl 4-[(8-methyl-2-oxo-4-phenylchromen-7-yl)oxymethyl]benzoate | ||
|---|---|---|---|---|
| CAS Number | 6238-88-6 | Molecular Weight | 400.42300 | |
| Density | 1.258g/cm3 | Boiling Point | 586.6ºC at 760 mmHg | |
| Molecular Formula | C25H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255ºC | |
| Name | methyl 4-[(8-methyl-2-oxo-4-phenylchromen-7-yl)oxymethyl]benzoate |
|---|
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 586.6ºC at 760 mmHg |
| Molecular Formula | C25H20O5 |
| Molecular Weight | 400.42300 |
| Flash Point | 255ºC |
| Exact Mass | 400.13100 |
| PSA | 65.74000 |
| LogP | 5.13400 |
| Index of Refraction | 1.621 |
| InChIKey | UERATCLCMHZRSU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(COc2ccc3c(-c4ccccc4)cc(=O)oc3c2C)cc1 |
|
~%
methyl 4-[(8-me... CAS#:6238-88-6 |
| Literature: Drain; Daly; Davy; Horlington; Howes; Scruton; Selway The Journal of pharmacy and pharmacology, 1970 , vol. 22, # 9 p. 684 - 693 |