4-hydroxy-2-methyl-5-nitrobenzenesulfonic acid structure
|
Common Name | 4-hydroxy-2-methyl-5-nitrobenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 62351-45-5 | Molecular Weight | 233.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydroxy-2-methyl-5-nitrobenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H7NO6S |
|---|---|
| Molecular Weight | 233.19900 |
| Exact Mass | 232.99900 |
| PSA | 128.80000 |
| LogP | 2.45950 |
| InChIKey | DMAIDQVCZHSRNA-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c([N+](=O)[O-])cc1S(=O)(=O)O |
|
~%
4-hydroxy-2-met... CAS#:62351-45-5 |
| Literature: Schultz Chemische Berichte, 1907 , vol. 40, p. 4319 |
|
~%
4-hydroxy-2-met... CAS#:62351-45-5 |
| Literature: Schultz Chemische Berichte, 1907 , vol. 40, p. 4319 |
|
~%
Detail
|
| Literature: Haworth; Lapworth Journal of the Chemical Society, 1924 , vol. 125, p. 1304 Journal of the Chemical Society, 1923 , vol. 123, p. 2991 |
| 4-Hydroxy-2-methyl-5-nitrobenzolsulfonsaeure |
| Benzenesulfonic acid,4-hydroxy-2-methyl-5-nitro |
| 6-Nitro-m-kresol-sulfonsaeure-(4) |
| 5-Hydroxy-4-nitro-toluol-2-sulfonsaeure |
| 5-hydroxy-4-nitro-toluene-2-sulfonic acid |