4-[(4-chlorobenzyl)oxy]benzoic acid
Modify Date: 2025-09-12 16:02:26
![4-[(4-chlorobenzyl)oxy]benzoic acid Structure](https://image.chemsrc.com/caspic/387/62290-40-8.png)
4-[(4-chlorobenzyl)oxy]benzoic acid structure
|
Common Name | 4-[(4-chlorobenzyl)oxy]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 62290-40-8 | Molecular Weight | 262.68800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11ClO3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 4-[(4-chlorophenyl)methoxy]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H11ClO3 |
|---|---|
| Molecular Weight | 262.68800 |
| Exact Mass | 262.04000 |
| PSA | 46.53000 |
| LogP | 3.61720 |
| InChIKey | WRELJNMKLNHYCU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(OCc2ccc(Cl)cc2)cc1 |
| HS Code | 2918990090 |
|---|
|
~%
4-[(4-chloroben... CAS#:62290-40-8 |
| Literature: Jones Journal of the Chemical Society, 1935 , p. 1835 Journal of the Chemical Society, 1938 , p. 1414 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-(4'-Chlorbenzyloxy)benzoesaeure |
| 4-[(4-chlorobenzyl)oxy]benzoic acid |
| 4-(4-Chlor-benzyloxy)-benzoesaeure |