(3-nitrophenyl)-pyridin-4-ylmethanone
Modify Date: 2025-08-25 12:41:55
(3-nitrophenyl)-pyridin-4-ylmethanone structure
|
Common Name | (3-nitrophenyl)-pyridin-4-ylmethanone | ||
|---|---|---|---|---|
| CAS Number | 62246-95-1 | Molecular Weight | 228.20400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-nitrophenyl)-pyridin-4-ylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8N2O3 |
|---|---|
| Molecular Weight | 228.20400 |
| Exact Mass | 228.05300 |
| PSA | 75.78000 |
| LogP | 2.74400 |
| InChIKey | NRWQXMJAOUMLEO-UHFFFAOYSA-N |
| SMILES | O=C(c1ccncc1)c1cccc([N+](=O)[O-])c1 |
|
~%
(3-nitrophenyl)... CAS#:62246-95-1 |
| Literature: Bryans; Pyman Journal of the Chemical Society, 1929 , p. 550 |
| 3-Nitrophenyl-4-pyridyl-keton |
| (3-nitro-phenyl)-pyridin-4-yl-methanone |
| (3-nitro-phenyl)-[4]pyridyl ketone |