3,5-dinitro-1-(4-nitrophenyl)pyridin-4-one structure
|
Common Name | 3,5-dinitro-1-(4-nitrophenyl)pyridin-4-one | ||
|---|---|---|---|---|
| CAS Number | 74197-40-3 | Molecular Weight | 306.18800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H6N4O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-dinitro-1-(4-nitrophenyl)pyridin-4-one |
|---|
| Molecular Formula | C11H6N4O7 |
|---|---|
| Molecular Weight | 306.18800 |
| Exact Mass | 306.02400 |
| PSA | 159.46000 |
| LogP | 3.13170 |
| InChIKey | HTAYVAFRCDMVNB-UHFFFAOYSA-N |
| SMILES | O=c1c([N+](=O)[O-])cn(-c2ccc([N+](=O)[O-])cc2)cc1[N+](=O)[O-] |
|
~68%
3,5-dinitro-1-(... CAS#:74197-40-3 |
| Literature: Matsumura; Kobayashi; Nishikawa; Ariga; Tohda; Kawashima Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 7 p. 1961 - 1965 |
|
~%
3,5-dinitro-1-(... CAS#:74197-40-3 |
| Literature: Matsumura; Kobayashi; Nishikawa; Ariga; Tohda; Kawashima Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 7 p. 1961 - 1965 |
|
~%
3,5-dinitro-1-(... CAS#:74197-40-3 |
| Literature: Matsumura; Kobayashi; Nishikawa; Ariga; Tohda; Kawashima Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 7 p. 1961 - 1965 |
| Precursor 3 | |
|---|---|
| DownStream 6 | |