bis(2,2,2-trifluoroethyl) phthalate
Modify Date: 2025-08-27 15:41:28
bis(2,2,2-trifluoroethyl) phthalate structure
|
Common Name | bis(2,2,2-trifluoroethyl) phthalate | ||
|---|---|---|---|---|
| CAS Number | 62240-27-1 | Molecular Weight | 330.18000 | |
| Density | 1.429g/cm3 | Boiling Point | 257.4ºC at 760 mmHg | |
| Molecular Formula | C12H8F6O4 | Melting Point | 41 °C | |
| MSDS | N/A | Flash Point | 106.2ºC | |
| Name | bis(2,2,2-trifluoroethyl) benzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.429g/cm3 |
|---|---|
| Boiling Point | 257.4ºC at 760 mmHg |
| Melting Point | 41 °C |
| Molecular Formula | C12H8F6O4 |
| Molecular Weight | 330.18000 |
| Flash Point | 106.2ºC |
| Exact Mass | 330.03300 |
| PSA | 52.60000 |
| LogP | 3.12480 |
| Index of Refraction | 1.432 |
| InChIKey | PSRBRNHUQJKQHV-UHFFFAOYSA-N |
| SMILES | O=C(OCC(F)(F)F)c1ccccc1C(=O)OCC(F)(F)F |
| Storage condition | Refrigerator |
| Hazard Codes | T+ |
|---|---|
| Risk Phrases | R26:Very Toxic by inhalation. R36/37/38:Irritating to eyes, respiratory system and skin . R40:Limited evidence of a carcinogenic effect. R42/43:May cause sensitization by inhalation and skin contact . R52/53:Harmful to aquatic organisms, may cause long-ter |
| Safety Phrases | S23-S36/37-S45-S61 |
| RIDADR | UN 2078 6.1/PG 2 |
| WGK Germany | 2 |
| RTECS | CZ6310000 |
| Packaging Group | II |
| Hazard Class | 6.1 |
| HS Code | 2917349000 |
| HS Code | 2917349000 |
|---|---|
| Summary | 2917349000 other esters of orthophthalic acid。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| p0785 |
| MFCD00059472 |