(2-hydroxy-2-methyl-1-phenyl-propyl)urea structure
|
Common Name | (2-hydroxy-2-methyl-1-phenyl-propyl)urea | ||
|---|---|---|---|---|
| CAS Number | 62183-18-0 | Molecular Weight | 208.25700 | |
| Density | 1.159g/cm3 | Boiling Point | 362.7ºC at 760 mmHg | |
| Molecular Formula | C11H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.2ºC | |
| Name | (2-hydroxy-2-methyl-1-phenylpropyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.159g/cm3 |
|---|---|
| Boiling Point | 362.7ºC at 760 mmHg |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.25700 |
| Flash Point | 173.2ºC |
| Exact Mass | 208.12100 |
| PSA | 75.35000 |
| LogP | 2.25810 |
| Index of Refraction | 1.563 |
| InChIKey | YYERWVNYRYAULN-UHFFFAOYSA-N |
| SMILES | CC(C)(O)C(NC(N)=O)c1ccccc1 |
|
~%
(2-hydroxy-2-me... CAS#:62183-18-0 |
| Literature: Cristol,S.J. et al. Journal of Organic Chemistry, 1977 , vol. 42, p. 2378 - 2379 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (2-hydroxy-2-methyl-1-phenyl-propyl)urea |