2-(2,4-Dichlorophenyl)-α-methyl-6-benzoxazoleacetic acid
Modify Date: 2025-09-13 08:53:08
2-(2,4-Dichlorophenyl)-α-methyl-6-benzoxazoleacetic acid structure
|
Common Name | 2-(2,4-Dichlorophenyl)-α-methyl-6-benzoxazoleacetic acid | ||
|---|---|---|---|---|
| CAS Number | 62143-78-6 | Molecular Weight | 336.16900 | |
| Density | 1.439g/cm3 | Boiling Point | 473.3ºC at 760 mmHg | |
| Molecular Formula | C16H11Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.1ºC | |
| Name | 2-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-6-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.439g/cm3 |
|---|---|
| Boiling Point | 473.3ºC at 760 mmHg |
| Molecular Formula | C16H11Cl2NO3 |
| Molecular Weight | 336.16900 |
| Flash Point | 240.1ºC |
| Exact Mass | 335.01200 |
| PSA | 63.33000 |
| LogP | 4.98970 |
| Index of Refraction | 1.644 |
| InChIKey | IQHPZIBKIKARIS-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)c1ccc2nc(-c3ccc(Cl)cc3Cl)oc2c1 |
| HS Code | 2934999090 |
|---|
|
~%
2-(2,4-Dichloro... CAS#:62143-78-6 |
| Literature: Dunwell,D.W.; Evans,D. Journal of Medicinal Chemistry, 1977 , vol. 20, p. 797 - 801 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[2-(2,4-dichloro-phenyl)-benzooxazol-6-yl]-propionic acid |