ethyl 3-chlorobenzoylformate
Modify Date: 2025-08-21 00:11:07
ethyl 3-chlorobenzoylformate structure
|
Common Name | ethyl 3-chlorobenzoylformate | ||
|---|---|---|---|---|
| CAS Number | 62123-73-3 | Molecular Weight | 212.63000 | |
| Density | 1.255g/cm3 | Boiling Point | 88ºC 0,1mm | |
| Molecular Formula | C10H9ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.9ºC | |
| Name | Ethyl 2-(3-chlorophenyl)-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 88ºC 0,1mm |
| Molecular Formula | C10H9ClO3 |
| Molecular Weight | 212.63000 |
| Flash Point | 129.9ºC |
| Exact Mass | 212.02400 |
| PSA | 43.37000 |
| LogP | 2.08580 |
| Index of Refraction | 1.528 |
| InChIKey | AORWOAPLLYVOEU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)c1cccc(Cl)c1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2918300090 |
|
~79%
ethyl 3-chlorob... CAS#:62123-73-3 |
| Literature: Shimizu, Hiroshi; Murakami, Masahiro Chemical Communications, 2007 , # 27 p. 2855 - 2857 |
|
~%
ethyl 3-chlorob... CAS#:62123-73-3 |
| Literature: Chemical Communications, , vol. 49, # 32 p. 3300 - 3302 |
|
~%
ethyl 3-chlorob... CAS#:62123-73-3 |
| Literature: Journal of Organic Chemistry, , vol. 73, # 10 p. 3842 - 3847 |
|
~41%
ethyl 3-chlorob... CAS#:62123-73-3 |
| Literature: Carpentier, Jean-Francois; Mortreux, Andre Tetrahedron Asymmetry, 1997 , vol. 8, # 7 p. 1083 - 1099 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD01319616 |
| ethyl 2-(3-chlorophenyl)-2-oxoacetate |