5-methyl-2-phenyl-1,3-dioxane-4,6-dione structure
|
Common Name | 5-methyl-2-phenyl-1,3-dioxane-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 62018-47-7 | Molecular Weight | 206.19500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methyl-2-phenyl-1,3-dioxane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10O4 |
|---|---|
| Molecular Weight | 206.19500 |
| Exact Mass | 206.05800 |
| PSA | 52.60000 |
| LogP | 1.42130 |
| InChIKey | SAPUXEMRWBJLEF-UHFFFAOYSA-N |
| SMILES | CC1C(=O)OC(c2ccccc2)OC1=O |
|
~%
5-methyl-2-phen... CAS#:62018-47-7 |
| Literature: Michael; Weiner Journal of the American Chemical Society, 1936 , vol. 58, p. 680,683 |
| 1,3-Dioxane-4,6-dione,5-methyl-2-phenyl |
| 2-phenyl-5-methyl-4,6-dioxo-1,3-dioxane |
| 5-Methyl-2-phenyl-[1,3]dioxan-4,6-dion |
| 5-methyl-2-phenyl-[1,3]dioxane-4,6-dione |