2-chloro-4-chlorosulfonylbenzoic acid
Modify Date: 2025-08-25 18:48:30
2-chloro-4-chlorosulfonylbenzoic acid structure
|
Common Name | 2-chloro-4-chlorosulfonylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 61953-04-6 | Molecular Weight | 255.07500 | |
| Density | 1.694g/cm3 | Boiling Point | 404.2ºC at 760mmHg | |
| Molecular Formula | C7H4Cl2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.2ºC | |
| Name | 2-chloro-4-chlorosulfonylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.694g/cm3 |
|---|---|
| Boiling Point | 404.2ºC at 760mmHg |
| Molecular Formula | C7H4Cl2O4S |
| Molecular Weight | 255.07500 |
| Flash Point | 198.2ºC |
| Exact Mass | 253.92100 |
| PSA | 79.82000 |
| LogP | 3.04650 |
| Index of Refraction | 1.599 |
| InChIKey | XYJQBDLJABAHGK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Cl)cc1Cl |
| HS Code | 2916399090 |
|---|
|
~35%
2-chloro-4-chlo... CAS#:61953-04-6 |
| Literature: Genetech, Inc.; Curis, Inc.; Cai, Xiong; Qian, Changgeng; Zhai, Haixiao Patent: US2014/18368 A1, 2014 ; Location in patent: Paragraph 0162; 0188 ; |
|
~%
2-chloro-4-chlo... CAS#:61953-04-6 |
| Literature: Genetech, Inc.; Curis, Inc.; Cai, Xiong; Qian, Changgeng; Zhai, Haixiao Patent: US2014/18368 A1, 2014 ; |
|
~%
2-chloro-4-chlo... CAS#:61953-04-6 |
| Literature: Farbenfabr.Bayer Patent: DE960197 , 1954 ; |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoicacid,2-chloro-4-(chlorosulfonyl) |
| 2-Chlor-4-chlorsulfonyl-benzoesaeure |
| 2-chloro-4-chlorosulfonyl-benzoic acid |