2-chloro-4-sulfobenzoic acid
Modify Date: 2025-08-25 23:18:18
2-chloro-4-sulfobenzoic acid structure
|
Common Name | 2-chloro-4-sulfobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 51084-27-6 | Molecular Weight | 236.63000 | |
| Density | 1.731g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H5ClO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-4-sulfobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.731g/cm3 |
|---|---|
| Molecular Formula | C7H5ClO5S |
| Molecular Weight | 236.63000 |
| Exact Mass | 235.95500 |
| PSA | 100.05000 |
| LogP | 2.36570 |
| Index of Refraction | 1.623 |
| InChIKey | ZTRKCBFXSUUQGS-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(S(=O)(=O)O)cc1Cl |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Chloro-4-sulfobenzoicacid |
| 2-Chloro-4-sulphobenzoic acid |
| 4-sulfo-2-chlorobenzoic acid |
| 2-Chlor-4-sulfo-benzoesaeure |
| Benzoic acid,2-chloro-4-sulfo |
| 3-chloro-4-carboxybenzenesulfonic acid |
| EINECS 256-957-1 |
| 2-Chlor-benzoesaeure-sulfonsaeure-(4) |