4-Chlorophenacyl 4-methylphenyl sulfone structure
|
Common Name | 4-Chlorophenacyl 4-methylphenyl sulfone | ||
|---|---|---|---|---|
| CAS Number | 61820-94-8 | Molecular Weight | 308.78000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-chlorophenyl)-2-(4-methylphenyl)sulfonylethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13ClO3S |
|---|---|
| Molecular Weight | 308.78000 |
| Exact Mass | 308.02700 |
| PSA | 59.59000 |
| LogP | 4.38580 |
| InChIKey | IEAKXYGMMHNCQB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CC(=O)c2ccc(Cl)cc2)cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-Chlorophenacyl 4'-tolyl sulfone |
| 2-(p-toluenesulfonyl)-4'-chloroacetophenone |
| 1-(4-chlorophenyl)-2-[(4-methylphenyl)sulfonyl]ethanone |
| 1-(4-chlorophenyl)-2-tosylethanone |