[[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]urea
Modify Date: 2025-09-27 23:34:24
![[[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]urea Structure](https://image.chemsrc.com/caspic/464/494758-35-9.png)
[[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]urea structure
|
Common Name | [[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]urea | ||
|---|---|---|---|---|
| CAS Number | 494758-35-9 | Molecular Weight | 283.32500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [[4-[(4-methylphenyl)methoxy]phenyl]methylideneamino]urea |
|---|
| Molecular Formula | C16H17N3O2 |
|---|---|
| Molecular Weight | 283.32500 |
| Exact Mass | 283.13200 |
| PSA | 77.70000 |
| LogP | 3.48090 |
| InChIKey | OPAANKAECICUEG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(COc2ccc(C=NNC(N)=O)cc2)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |