3-Chloro-5-nitrophenol structure
|
Common Name | 3-Chloro-5-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 618-63-3 | Molecular Weight | 173.554 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 288.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C6H4ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.2±23.2 °C | |
| Name | 3-Chloro-5-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 288.4±25.0 °C at 760 mmHg |
| Molecular Formula | C6H4ClNO3 |
| Molecular Weight | 173.554 |
| Flash Point | 128.2±23.2 °C |
| Exact Mass | 172.987976 |
| PSA | 66.05000 |
| LogP | 2.94 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | HIZPNTCIGGXRIF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(O)cc(Cl)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2908999090 |
|
~67%
3-Chloro-5-nitr... CAS#:618-63-3 |
| Literature: BAYER HEALTHCARE AG Patent: WO2009/33581 A1, 2009 ; Location in patent: Page/Page column 94-95 ; |
|
~57%
3-Chloro-5-nitr... CAS#:618-63-3 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GMBH Patent: WO2008/113760 A2, 2008 ; Location in patent: Page/Page column 108-109 ; WO 2008/113760 A2 |
|
~%
3-Chloro-5-nitr... CAS#:618-63-3 |
| Literature: Blanksma Recueil des Travaux Chimiques des Pays-Bas, 1908 , vol. 27, p. 36 |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Phenol, 3-chloro-5-nitro- |
| 5-chloro-3-nitrophenol |
| CL8484 |
| 3-Chloro-5-nitrophenol |