1-[(2-fluorophenyl)methyl]-3-(3-methoxyphenyl)-1-(oxolan-2-ylmethyl)thiourea structure
|
Common Name | 1-[(2-fluorophenyl)methyl]-3-(3-methoxyphenyl)-1-(oxolan-2-ylmethyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 6175-48-0 | Molecular Weight | 374.47200 | |
| Density | 1.253g/cm3 | Boiling Point | 499.4ºC at 760 mmHg | |
| Molecular Formula | C20H23FN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(2-fluorophenyl)methyl]-3-(3-methoxyphenyl)-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 499.4ºC at 760 mmHg |
| Molecular Formula | C20H23FN2O2S |
| Molecular Weight | 374.47200 |
| Exact Mass | 374.14600 |
| PSA | 72.86000 |
| LogP | 4.43280 |
| Index of Refraction | 1.622 |
| InChIKey | DZEDYAARFCIOKA-UHFFFAOYSA-N |
| SMILES | COc1cccc(NC(=S)N(Cc2ccccc2F)CC2CCCO2)c1 |
|
~45%
1-[(2-fluorophe... CAS#:6175-48-0 |
| Literature: Eremeev; Danov; Skudin; Sakhipov Russian Journal of General Chemistry, 2003 , vol. 73, # 4 p. 556 - 559 |
| 3-Aethyl-octan-2-on |