2-bis(4-chlorophenyl)boranyloxyethanamine structure
|
Common Name | 2-bis(4-chlorophenyl)boranyloxyethanamine | ||
|---|---|---|---|---|
| CAS Number | 61733-90-2 | Molecular Weight | 293.98400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14BCl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bis(4-chlorophenyl)boranyloxyethanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14BCl2NO |
|---|---|
| Molecular Weight | 293.98400 |
| Exact Mass | 293.05500 |
| PSA | 35.25000 |
| LogP | 2.77470 |
| InChIKey | GUTSQJZPTFKRPI-UHFFFAOYSA-N |
| SMILES | NCCOB(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
|
~%
2-bis(4-chlorop... CAS#:61733-90-2 |
| Literature: Tabuchi, Hitoshi; Kawaguchi, Harumoto; Taniguchi, Hisashi; Imazaki, Hideyuki; Hayase, Yoshio Heterocycles, 2002 , vol. 57, # 7 p. 1319 - 1326 |
|
~99%
2-bis(4-chlorop... CAS#:61733-90-2 |
| Literature: Kliegel, Wolfgang; Ahlenstiel, Eckart Journal of Organometallic Chemistry, 1984 , vol. 277, # 2 p. 173 - 188 |
|
~%
2-bis(4-chlorop... CAS#:61733-90-2 |
| Literature: Povlock; Lippincott Journal of the American Chemical Society, 1958 , vol. 80, p. 5409 |
|
~%
2-bis(4-chlorop... CAS#:61733-90-2 |
| Literature: Coates,G.E.; Livingstone,J.G. Journal of the Chemical Society, 1961 , p. 4909 - 4911 |
| 2-[Bis-(4-chlor-phenyl)-boryloxy]-aethylamin |
| (2-Amino-aethoxy)-bis-(4-chlor-phenyl)-boran |
| 2-aminoethyl (4-chlorophenyl)phenylborate |
| Di-p-chlorphenylborinsaeure-2-amino-ethylester |
| di-(p-chlorophenyl)borinic acid ethanolamine ester |
| Borinic acid,bis(4-chlorophenyl)-,2-aminoethyl ester |
| 2-[bis-(4-chloro-phenyl)-boranyloxy]-ethylamine |
| B-(2-aminoethoxy)bis(4-chlorophenyl)borane |